C24H24FNO5 — CID 146604961
(2S,3R,4S,5S,6S)-5-amino-2-[3-[(E)-2-(2-fluorophenyl)ethenyl]naphthalen-2-yl]oxy-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 146604961) has the molecular formula C24H24FNO5 and a molecular weight of 425.46 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-5-amino-2-[3-[(E)-2-(2-fluorophenyl)ethenyl]naphthalen-2-yl]oxy-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S,6S)-5-amino-2-[3-[(E)-2-(2-fluorophenyl)ethenyl]naphthalen-2-yl]oxy-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 146604961 |
| Molecular Formula | C24H24FNO5 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | (2S,3R,4S,5S,6S)-5-amino-2-[3-[(E)-2-(2-fluorophenyl)ethenyl]naphthalen-2-yl]oxy-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | N[C@H]1[C@H](O)[C@@H](O)[C@H](Oc2cc3ccccc3cc2/C=C/c2ccccc2F)O[C@@H]1CO |
| InChI | InChI=1S/C24H24FNO5/c25-18-8-4-3-5-14(18)9-10-17-11-15-6-1-2-7-16(15)12-19(17)30-24-23(29)22(28)21(26)20(13-27)31-24/h1-12,20-24,27-29H,13,26H2/b10-9+/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | IZLRLIMSGKLTBM-CHCLVBBRSA-N |
| XLogP | 2.29 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|