C13H7F19O3S — CID 146606445
[(Z)-1,1,1,4,4,5,5,8,8,8-decafluorooct-6-en-3-yl] 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-sulfonate (PubChem CID 146606445) has the molecular formula C13H7F19O3S and a molecular weight of 604.22 g/mol. Its IUPAC name is [(Z)-1,1,1,4,4,5,5,8,8,8-decafluorooct-6-en-3-yl] 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-sulfonate.
| Compound Name | [(Z)-1,1,1,4,4,5,5,8,8,8-decafluorooct-6-en-3-yl] 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 146606445 |
| Molecular Formula | C13H7F19O3S |
| Molecular Weight | 604.22 g/mol |
| Exact Mass | 603.98 |
| IUPAC Name | [(Z)-1,1,1,4,4,5,5,8,8,8-decafluorooct-6-en-3-yl] 2,2,3,3,4,4,5,5,5-nonafluoropentane-1-sulfonate |
| SMILES | O=S(=O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(CC(F)(F)F)C(F)(F)C(F)(F)/C=C\C(F)(F)F |
| InChI | InChI=1S/C13H7F19O3S/c14-6(15,1-2-8(18,19)20)10(24,25)5(3-9(21,22)23)35-36(33,34)4-7(16,17)11(26,27)12(28,29)13(30,31)32/h1-2,5H,3-4H2/b2-1- |
| InChIKey | FQWCKVGSLVPLNT-UPHRSURJSA-N |
| XLogP | 6.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.22 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|