C14H7F3N2O2S — CID 146610879
7-imino-2-[4-(trifluoromethyl)phenyl]thieno[3,2-c]pyridine-4,6-dione (PubChem CID 146610879) has the molecular formula C14H7F3N2O2S and a molecular weight of 324.28 g/mol. Its IUPAC name is 7-imino-2-[4-(trifluoromethyl)phenyl]thieno[3,2-c]pyridine-4,6-dione.
| Compound Name | 7-imino-2-[4-(trifluoromethyl)phenyl]thieno[3,2-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 146610879 |
| Molecular Formula | C14H7F3N2O2S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 7-imino-2-[4-(trifluoromethyl)phenyl]thieno[3,2-c]pyridine-4,6-dione |
| SMILES | [H]/N=C1\C(=O)NC(=O)c2cc(-c3ccc(C(F)(F)F)cc3)sc21 |
| InChI | InChI=1S/C14H7F3N2O2S/c15-14(16,17)7-3-1-6(2-4-7)9-5-8-11(22-9)10(18)13(21)19-12(8)20/h1-5,18H,(H,19,20,21)/b18-10- |
| InChIKey | KOSNPFKKHBCHTR-ZDLGFXPLSA-N |
| XLogP | 3.07 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|