C42H18F18S2 — CID 148870480
3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis[4-(trifluoromethyl)phenyl]-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene (PubChem CID 148870480) has the molecular formula C42H18F18S2 and a molecular weight of 928.70 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis[4-(trifluoromethyl)phenyl]-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis[4-(trifluoromethyl)phenyl]-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene |
|---|---|
| PubChem CID | 148870480 |
| Molecular Formula | C42H18F18S2 |
| Molecular Weight | 928.70 g/mol |
| Exact Mass | 928.06 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-9,12,12,15-tetrakis[4-(trifluoromethyl)phenyl]-10,14-dithiatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),2(6),7(11),8,15-pentaene |
| SMILES | FC(F)(F)c1ccc(-c2cc3c(s2)C(c2ccc(C(F)(F)F)cc2)(c2ccc(C(F)(F)F)cc2)c2sc(-c4ccc(C(F)(F)F)cc4)cc2C2=C3C(F)(F)C(F)(F)C2(F)F)cc1 |
| InChI | InChI=1S/C42H18F18S2/c43-36(44)31-27-17-29(19-1-5-23(6-2-19)38(47,48)49)61-33(27)35(21-9-13-25(14-10-21)40(53,54)55,22-11-15-26(16-12-22)41(56,57)58)34-28(32(31)37(45,46)42(36,59)60)18-30(62-34)20-3-7-24(8-4-20)39(50,51)52/h1-18H |
| InChIKey | PBBOJLVDBQUVNE-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.70 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|