C26H41Br2NO13 — CID 146634815
2-[2-[2-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethoxy]ethoxy]ethoxy]ethyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-(2-bromo-2-methylpropoxy)-2-methylpropanoate (PubChem CID 146634815) has the molecular formula C26H41Br2NO13 and a molecular weight of 735.42 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethoxy]ethoxy]ethoxy]ethyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-(2-bromo-2-methylpropoxy)-2-methylpropanoate.
| Compound Name | 2-[2-[2-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethoxy]ethoxy]ethoxy]ethyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-(2-bromo-2-methylpropoxy)-2-methylpropanoate |
|---|---|
| PubChem CID | 146634815 |
| Molecular Formula | C26H41Br2NO13 |
| Molecular Weight | 735.42 g/mol |
| Exact Mass | 733.09 |
| IUPAC Name | 2-[2-[2-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxyethoxy]ethoxy]ethoxy]ethyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-(2-bromo-2-methylpropoxy)-2-methylpropanoate |
| SMILES | CC(C)(Br)COCC(C)(COC(=O)C(C)(C)Br)C(=O)OCCOCCOCCOCCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H41Br2NO13/c1-24(2,27)16-38-17-26(5,18-41-21(32)25(3,4)28)22(33)39-14-12-36-10-8-35-9-11-37-13-15-40-23(34)42-29-19(30)6-7-20(29)31/h6-18H2,1-5H3 |
| InChIKey | KAFUOWLMNLVQRG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 162.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|