C7H5FI3N — CID 146655138
3-fluoro-N,N,2-triiodo-5-methylaniline (PubChem CID 146655138) has the molecular formula C7H5FI3N and a molecular weight of 502.83 g/mol. Its IUPAC name is 3-fluoro-N,N,2-triiodo-5-methylaniline.
| Compound Name | 3-fluoro-N,N,2-triiodo-5-methylaniline |
|---|---|
| PubChem CID | 146655138 |
| Molecular Formula | C7H5FI3N |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.75 |
| IUPAC Name | 3-fluoro-N,N,2-triiodo-5-methylaniline |
| SMILES | Cc1cc(F)c(I)c(N(I)I)c1 |
| InChI | InChI=1S/C7H5FI3N/c1-4-2-5(8)7(9)6(3-4)12(10)11/h2-3H,1H3 |
| InChIKey | BSAPTIAMFMQXMQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|