C19H28N2O4S2 — CID 146656612
[5-[[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]methyl]-1-methylimidazol-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate (PubChem CID 146656612) has the molecular formula C19H28N2O4S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is [5-[[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]methyl]-1-methylimidazol-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate.
| Compound Name | [5-[[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]methyl]-1-methylimidazol-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
|---|---|
| PubChem CID | 146656612 |
| Molecular Formula | C19H28N2O4S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [5-[[(3R,4S)-4-ethyl-5-oxooxolan-3-yl]methyl]-1-methylimidazol-2-yl] 5-[(3S)-dithiolan-3-yl]pentanoate |
| SMILES | CC[C@@H]1C(=O)OC[C@@H]1Cc1cnc(OC(=O)CCCC[C@H]2CCSS2)n1C |
| InChI | InChI=1S/C19H28N2O4S2/c1-3-16-13(12-24-18(16)23)10-14-11-20-19(21(14)2)25-17(22)7-5-4-6-15-8-9-26-27-15/h11,13,15-16H,3-10,12H2,1-2H3/t13-,15-,16-/m0/s1 |
| InChIKey | VUAZXELGAIYUHO-BPUTZDHNSA-N |
| XLogP | 3.78 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|