C25H24N2O6 — CID 146657176
(4aS,14aR)-7-(dimethylamino)-1,13,14a-trihydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 146657176) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is (4aS,14aR)-7-(dimethylamino)-1,13,14a-trihydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4aS,14aR)-7-(dimethylamino)-1,13,14a-trihydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 146657176 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (4aS,14aR)-7-(dimethylamino)-1,13,14a-trihydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)c1c2c(cc3ccccc13)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3CC1C2 |
| InChI | InChI=1S/C25H24N2O6/c1-27(2)20-14-6-4-3-5-11(14)8-16-15(20)9-12-7-13-10-17(28)19(24(26)32)23(31)25(13,33)22(30)18(12)21(16)29/h3-6,8,12-13,29,31,33H,7,9-10H2,1-2H3,(H2,26,32)/t12?,13-,25-/m0/s1 |
| InChIKey | HSBCDZJXYLVCIK-IQYZIMNOSA-N |
| XLogP | 1.94 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|