C16H20O3 — CID 146657626
2,2-dimethyl-7-pentylchromene-5,8-dione (PubChem CID 146657626) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2,2-dimethyl-7-pentylchromene-5,8-dione.
| Compound Name | 2,2-dimethyl-7-pentylchromene-5,8-dione |
|---|---|
| PubChem CID | 146657626 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2,2-dimethyl-7-pentylchromene-5,8-dione |
| SMILES | CCCCCC1=CC(=O)C2=C(OC(C)(C)C=C2)C1=O |
| InChI | InChI=1S/C16H20O3/c1-4-5-6-7-11-10-13(17)12-8-9-16(2,3)19-15(12)14(11)18/h8-10H,4-7H2,1-3H3 |
| InChIKey | AUQGRVHLRKSYRW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|