C17H16O6 — CID 78089985
2-but-2-enoyl-4,6,8-trimethoxynaphthalene-1,5-dione (PubChem CID 78089985) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-but-2-enoyl-4,6,8-trimethoxynaphthalene-1,5-dione.
| Compound Name | 2-but-2-enoyl-4,6,8-trimethoxynaphthalene-1,5-dione |
|---|---|
| PubChem CID | 78089985 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-but-2-enoyl-4,6,8-trimethoxynaphthalene-1,5-dione |
| SMILES | CC=CC(=O)C1=CC(OC)=C2C(=O)C(OC)=CC(OC)=C2C1=O |
| InChI | InChI=1S/C17H16O6/c1-5-6-10(18)9-7-11(21-2)15-14(16(9)19)12(22-3)8-13(23-4)17(15)20/h5-8H,1-4H3 |
| InChIKey | CKKPHLIVNZHLHD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|