C6H17N2P — CID 146664889
N,N,N'-trimethyl-N'-methylphosphanylethane-1,2-diamine (PubChem CID 146664889) has the molecular formula C6H17N2P and a molecular weight of 148.19 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-methylphosphanylethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-methylphosphanylethane-1,2-diamine |
|---|---|
| PubChem CID | 146664889 |
| Molecular Formula | C6H17N2P |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | N,N,N'-trimethyl-N'-methylphosphanylethane-1,2-diamine |
| SMILES | CPN(C)CCN(C)C |
| InChI | InChI=1S/C6H17N2P/c1-7(2)5-6-8(3)9-4/h9H,5-6H2,1-4H3 |
| InChIKey | AZTUACIMWZABRY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|