C56H40N4O — CID 146671918
9-[4-(6-cyclohexa-1,3-dien-1-yl-2-phenylpyrimidin-4-yl)phenyl]-6-phenanthren-9-yl-2-phenyl-1,2,6,7-tetrahydro-[1,3]oxazolo[5,4-k]phenanthridine (PubChem CID 146671918) has the molecular formula C56H40N4O and a molecular weight of 784.96 g/mol. Its IUPAC name is 9-[4-(6-cyclohexa-1,3-dien-1-yl-2-phenylpyrimidin-4-yl)phenyl]-6-phenanthren-9-yl-2-phenyl-1,2,6,7-tetrahydro-[1,3]oxazolo[5,4-k]phenanthridine.
| Compound Name | 9-[4-(6-cyclohexa-1,3-dien-1-yl-2-phenylpyrimidin-4-yl)phenyl]-6-phenanthren-9-yl-2-phenyl-1,2,6,7-tetrahydro-[1,3]oxazolo[5,4-k]phenanthridine |
|---|---|
| PubChem CID | 146671918 |
| Molecular Formula | C56H40N4O |
| Molecular Weight | 784.96 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | 9-[4-(6-cyclohexa-1,3-dien-1-yl-2-phenylpyrimidin-4-yl)phenyl]-6-phenanthren-9-yl-2-phenyl-1,2,6,7-tetrahydro-[1,3]oxazolo[5,4-k]phenanthridine |
| SMILES | C1=CCCC(c2cc(-c3ccc(-c4ccc5c(c4)NC(c4cc6ccccc6c6ccccc46)c4ccc6c(c4-5)NC(c4ccccc4)O6)cc3)nc(-c3ccccc3)n2)=C1 |
| InChI | InChI=1S/C56H40N4O/c1-4-14-36(15-5-1)48-34-49(59-55(58-48)38-16-6-2-7-17-38)37-26-24-35(25-27-37)40-28-29-45-50(33-40)57-53(47-32-41-20-10-11-21-42(41)43-22-12-13-23-44(43)47)46-30-31-51-54(52(45)46)60-56(61-51)39-18-8-3-9-19-39/h1-4,6-14,16-34,53,56-57,60H,5,15H2 |
| InChIKey | BYYUQJIEKSVHMR-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.96 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|