C26H32O8 — CID 146684340
2-(4-hydroxyphenyl)ethyl 2-[2-(8-acetyloxyoctanoyl)-3,5-dihydroxyphenyl]acetate (PubChem CID 146684340) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl 2-[2-(8-acetyloxyoctanoyl)-3,5-dihydroxyphenyl]acetate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl 2-[2-(8-acetyloxyoctanoyl)-3,5-dihydroxyphenyl]acetate |
|---|---|
| PubChem CID | 146684340 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl 2-[2-(8-acetyloxyoctanoyl)-3,5-dihydroxyphenyl]acetate |
| SMILES | CC(=O)OCCCCCCCC(=O)c1c(O)cc(O)cc1CC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C26H32O8/c1-18(27)33-13-6-4-2-3-5-7-23(30)26-20(15-22(29)17-24(26)31)16-25(32)34-14-12-19-8-10-21(28)11-9-19/h8-11,15,17,28-29,31H,2-7,12-14,16H2,1H3 |
| InChIKey | DLCHRERBBZWJJJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|