C20H22O3S2 — CID 14674057
2-[1-[4-(3,4-dimethoxyphenoxy)phenyl]ethylidene]-1,3-dithiane (PubChem CID 14674057) has the molecular formula C20H22O3S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[1-[4-(3,4-dimethoxyphenoxy)phenyl]ethylidene]-1,3-dithiane.
| Compound Name | 2-[1-[4-(3,4-dimethoxyphenoxy)phenyl]ethylidene]-1,3-dithiane |
|---|---|
| PubChem CID | 14674057 |
| Molecular Formula | C20H22O3S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[1-[4-(3,4-dimethoxyphenoxy)phenyl]ethylidene]-1,3-dithiane |
| SMILES | COc1ccc(Oc2ccc(C(C)=C3SCCCS3)cc2)cc1OC |
| InChI | InChI=1S/C20H22O3S2/c1-14(20-24-11-4-12-25-20)15-5-7-16(8-6-15)23-17-9-10-18(21-2)19(13-17)22-3/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | SQRSRZQAYIGNOR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |