C30H29N3O3S — CID 146974224
(4S)-N-(4-methoxyphenyl)-N-methyl-6-oxo-18-thia-5,15-diazapentacyclo[18.3.1.02,4.08,16.09,14]tetracosa-1(23),8(16),9,11,13,20(24),21-heptaene-4-carboxamide (PubChem CID 146974224) has the molecular formula C30H29N3O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is (4S)-N-(4-methoxyphenyl)-N-methyl-6-oxo-18-thia-5,15-diazapentacyclo[18.3.1.02,4.08,16.09,14]tetracosa-1(23),8(16),9,11,13,20(24),21-heptaene-4-carboxamide.
| Compound Name | (4S)-N-(4-methoxyphenyl)-N-methyl-6-oxo-18-thia-5,15-diazapentacyclo[18.3.1.02,4.08,16.09,14]tetracosa-1(23),8(16),9,11,13,20(24),21-heptaene-4-carboxamide |
|---|---|
| PubChem CID | 146974224 |
| Molecular Formula | C30H29N3O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | (4S)-N-(4-methoxyphenyl)-N-methyl-6-oxo-18-thia-5,15-diazapentacyclo[18.3.1.02,4.08,16.09,14]tetracosa-1(23),8(16),9,11,13,20(24),21-heptaene-4-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@]23CC2c2cccc(c2)CSCc2[nH]c4ccccc4c2CC(=O)N3)cc1 |
| InChI | InChI=1S/C30H29N3O3S/c1-33(21-10-12-22(36-2)13-11-21)29(35)30-16-25(30)20-7-5-6-19(14-20)17-37-18-27-24(15-28(34)32-30)23-8-3-4-9-26(23)31-27/h3-14,25,31H,15-18H2,1-2H3,(H,32,34)/t25?,30-/m0/s1 |
| InChIKey | ANALPAKCBPDLJS-QNGSWNHHSA-N |
| XLogP | 5.17 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|