C30H33N3O3 — CID 130286854
(17S)-15-hydroxy-N-(4-methoxyphenyl)-N-methyl-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7,9,11,19,21-heptaene-17-carboxamide (PubChem CID 130286854) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is (17S)-15-hydroxy-N-(4-methoxyphenyl)-N-methyl-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7,9,11,19,21-heptaene-17-carboxamide.
| Compound Name | (17S)-15-hydroxy-N-(4-methoxyphenyl)-N-methyl-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7,9,11,19,21-heptaene-17-carboxamide |
|---|---|
| PubChem CID | 130286854 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (17S)-15-hydroxy-N-(4-methoxyphenyl)-N-methyl-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(23),5(13),7,9,11,19,21-heptaene-17-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@@H]2Cc3cccc(c3)CCCc3[nH]c4ccccc4c3CC(O)N2)cc1 |
| InChI | InChI=1S/C30H33N3O3/c1-33(22-13-15-23(36-2)16-14-22)30(35)28-18-21-9-5-7-20(17-21)8-6-12-27-25(19-29(34)32-28)24-10-3-4-11-26(24)31-27/h3-5,7,9-11,13-17,28-29,31-32,34H,6,8,12,18-19H2,1-2H3/t28-,29?/m0/s1 |
| InChIKey | AFZKKDRMLCSRJE-XLTVJXRZSA-N |
| XLogP | 4.39 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|