C31H35N3O2 — CID 130286133
(18S)-N-(4-methoxyphenyl)-N-methyl-7,17-diazatetracyclo[18.3.1.06,14.08,13]tetracosa-1(24),6(14),8,10,12,20,22-heptaene-18-carboxamide (PubChem CID 130286133) has the molecular formula C31H35N3O2 and a molecular weight of 481.64 g/mol. Its IUPAC name is (18S)-N-(4-methoxyphenyl)-N-methyl-7,17-diazatetracyclo[18.3.1.06,14.08,13]tetracosa-1(24),6(14),8,10,12,20,22-heptaene-18-carboxamide.
| Compound Name | (18S)-N-(4-methoxyphenyl)-N-methyl-7,17-diazatetracyclo[18.3.1.06,14.08,13]tetracosa-1(24),6(14),8,10,12,20,22-heptaene-18-carboxamide |
|---|---|
| PubChem CID | 130286133 |
| Molecular Formula | C31H35N3O2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (18S)-N-(4-methoxyphenyl)-N-methyl-7,17-diazatetracyclo[18.3.1.06,14.08,13]tetracosa-1(24),6(14),8,10,12,20,22-heptaene-18-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@@H]2Cc3cccc(c3)CCCCc3[nH]c4ccccc4c3CCN2)cc1 |
| InChI | InChI=1S/C31H35N3O2/c1-34(24-14-16-25(36-2)17-15-24)31(35)30-21-23-10-7-9-22(20-23)8-3-5-12-29-27(18-19-32-30)26-11-4-6-13-28(26)33-29/h4,6-7,9-11,13-17,20,30,32-33H,3,5,8,12,18-19,21H2,1-2H3/t30-/m0/s1 |
| InChIKey | PXVDTHKPALNCMY-PMERELPUSA-N |
| XLogP | 5.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|