C29H29N3O5S — CID 76901025
(17S)-N-(4-methoxyphenyl)-N-methyl-3,3,15-trioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide (PubChem CID 76901025) has the molecular formula C29H29N3O5S and a molecular weight of 531.63 g/mol. Its IUPAC name is (17S)-N-(4-methoxyphenyl)-N-methyl-3,3,15-trioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide.
| Compound Name | (17S)-N-(4-methoxyphenyl)-N-methyl-3,3,15-trioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide |
|---|---|
| PubChem CID | 76901025 |
| Molecular Formula | C29H29N3O5S |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (17S)-N-(4-methoxyphenyl)-N-methyl-3,3,15-trioxo-3λ6-thia-6,16-diazatetracyclo[17.3.1.05,13.07,12]tricosa-1(22),5(13),7,9,11,19(23),20-heptaene-17-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@@H]2Cc3cccc(c3)CS(=O)(=O)Cc3[nH]c4ccccc4c3CC(=O)N2)cc1 |
| InChI | InChI=1S/C29H29N3O5S/c1-32(21-10-12-22(37-2)13-11-21)29(34)26-15-19-6-5-7-20(14-19)17-38(35,36)18-27-24(16-28(33)31-26)23-8-3-4-9-25(23)30-27/h3-14,26,30H,15-18H2,1-2H3,(H,31,33)/t26-/m0/s1 |
| InChIKey | AGPRQISCKHPESN-SANMLTNESA-N |
| XLogP | 3.54 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|