C27H18I3O3S+ — CID 146998384
10-[4-[2-(2,4,6-triiodophenoxy)ethoxy]phenyl]thioxanthen-10-ium-9-one (PubChem CID 146998384) has the molecular formula C27H18I3O3S+ and a molecular weight of 803.22 g/mol. Its IUPAC name is 10-[4-[2-(2,4,6-triiodophenoxy)ethoxy]phenyl]thioxanthen-10-ium-9-one.
| Compound Name | 10-[4-[2-(2,4,6-triiodophenoxy)ethoxy]phenyl]thioxanthen-10-ium-9-one |
|---|---|
| PubChem CID | 146998384 |
| Molecular Formula | C27H18I3O3S+ |
| Molecular Weight | 803.22 g/mol |
| Exact Mass | 802.81 |
| IUPAC Name | 10-[4-[2-(2,4,6-triiodophenoxy)ethoxy]phenyl]thioxanthen-10-ium-9-one |
| SMILES | O=c1c2ccccc2[s+](-c2ccc(OCCOc3c(I)cc(I)cc3I)cc2)c2ccccc12 |
| InChI | InChI=1S/C27H18I3O3S/c28-17-15-22(29)27(23(30)16-17)33-14-13-32-18-9-11-19(12-10-18)34-24-7-3-1-5-20(24)26(31)21-6-2-4-8-25(21)34/h1-12,15-16H,13-14H2/q+1 |
| InChIKey | ARNYOPRBPHQCRC-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.22 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|