C24H32N2O2 — CID 147039309
N-[(3,5-dimethylphenyl)methyl]-2-(9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl)ethanamine (PubChem CID 147039309) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-2-(9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl)ethanamine.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-2-(9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl)ethanamine |
|---|---|
| PubChem CID | 147039309 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-2-(9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl)ethanamine |
| SMILES | Cc1cc(C)cc(CNCCC2(c3ccccn3)CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C24H32N2O2/c1-19-13-20(2)15-21(14-19)16-25-10-6-23(22-5-3-4-9-26-22)7-12-28-24(17-23)8-11-27-18-24/h3-5,9,13-15,25H,6-8,10-12,16-18H2,1-2H3 |
| InChIKey | AZDFWHQTVHQAQX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|