C22H26Cl2N2O2 — CID 155054307
N-[(3,5-dichlorophenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 155054307) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 155054307 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | Clc1cc(Cl)cc(CNCC[C@@]2(c3ccccn3)CCO[C@]3(CCOC3)C2)c1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c23-18-11-17(12-19(24)13-18)14-25-8-4-21(20-3-1-2-7-26-20)5-10-28-22(15-21)6-9-27-16-22/h1-3,7,11-13,25H,4-6,8-10,14-16H2/t21-,22-/m1/s1 |
| InChIKey | TULZHRNCVQGJOS-FGZHOGPDSA-N |
| XLogP | 4.78 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|