C23H30N2O2 — CID 149018948
N-[(3-methylphenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 149018948) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-[(3-methylphenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 149018948 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-2-[(5S,9R)-9-pyridin-2-yl-2,6-dioxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | Cc1cccc(CNCC[C@@]2(c3ccccn3)CCO[C@]3(CCOC3)C2)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-19-5-4-6-20(15-19)16-24-12-8-22(21-7-2-3-11-25-21)9-14-27-23(17-22)10-13-26-18-23/h2-7,11,15,24H,8-10,12-14,16-18H2,1H3/t22-,23-/m1/s1 |
| InChIKey | QDBYXSKOJNEYQG-DHIUTWEWSA-N |
| XLogP | 3.78 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|