C22H30FN3O — CID 145335754
N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methyl-2-propyl-4-pyridin-2-yloxan-4-yl)ethanamine (PubChem CID 145335754) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methyl-2-propyl-4-pyridin-2-yloxan-4-yl)ethanamine.
| Compound Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methyl-2-propyl-4-pyridin-2-yloxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 145335754 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | N-[(5-fluoro-3-pyridinyl)methyl]-2-(2-methyl-2-propyl-4-pyridin-2-yloxan-4-yl)ethanamine |
| SMILES | CCCC1(C)CC(CCNCc2cncc(F)c2)(c2ccccn2)CCO1 |
| InChI | InChI=1S/C22H30FN3O/c1-3-7-21(2)17-22(9-12-27-21,20-6-4-5-10-26-20)8-11-24-14-18-13-19(23)16-25-15-18/h4-6,10,13,15-16,24H,3,7-9,11-12,14,17H2,1-2H3 |
| InChIKey | VIVZXRGJUUUOFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|