C23H22N2O5 — CID 147255172
methyl 6-[7-oxo-7-(5-phenyl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate (PubChem CID 147255172) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 6-[7-oxo-7-(5-phenyl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[7-oxo-7-(5-phenyl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 147255172 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | methyl 6-[7-oxo-7-(5-phenyl-1,2-oxazol-3-yl)heptanoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)CCCCCC(=O)c2cc(-c3ccccc3)on2)nc1 |
| InChI | InChI=1S/C23H22N2O5/c1-29-23(28)17-12-13-18(24-15-17)20(26)10-6-3-7-11-21(27)19-14-22(30-25-19)16-8-4-2-5-9-16/h2,4-5,8-9,12-15H,3,6-7,10-11H2,1H3 |
| InChIKey | CNLRBDJVRIKTOX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|