C11H10 — CID 14737125
cyclopenta-1,2-dien-1-ylbenzene (PubChem CID 14737125) has the molecular formula C11H10 and a molecular weight of 142.20 g/mol. Its IUPAC name is cyclopenta-1,2-dien-1-ylbenzene.
| Compound Name | cyclopenta-1,2-dien-1-ylbenzene |
|---|---|
| PubChem CID | 14737125 |
| Molecular Formula | C11H10 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | cyclopenta-1,2-dien-1-ylbenzene |
| SMILES | C1=CCCC=1c1ccccc1 |
| InChI | InChI=1S/C11H10/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-4,6-7H,5,9H2 |
| InChIKey | RXPWNPDLYXRTRL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |