About 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione
1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione (PubChem CID 147460696) has the molecular formula C5H4INO2
and a molecular weight of 237.00 g/mol. Its IUPAC name is 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione |
| PubChem CID | 147460696 |
| Molecular Formula | C5H4INO2 |
| Molecular Weight | 237.00 g/mol |
| Exact Mass | 236.93 |
| IUPAC Name | 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione |
| SMILES | C=IN1C(=O)C=CC1=O |
| InChI | InChI=1S/C5H4INO2/c1-6-7-4(8)2-3-5(7)9/h2-3H,1H2 |
| InChIKey | DZWPAAMUPQBZFR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.00 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione?
The IUPAC name of 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione (CID 147460696) is 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione?
The canonical SMILES for 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione is C=IN1C(=O)C=CC1=O.
What is the InChIKey of 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione?
The InChIKey is DZWPAAMUPQBZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4INO2/c1-6-7-4(8)2-3-5(7)9/h2-3H,1H2.
What are the key properties of 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione?
1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione has a molecular weight of 237.00 g/mol, XLogP of 0.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylidene-λ3-iodanyl)pyrrole-2,5-dione is sourced from PubChem (CID 147460696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).