C4H2NO3P — CID 130463981
1-phosphorosopyrrole-2,5-dione (PubChem CID 130463981) has the molecular formula C4H2NO3P and a molecular weight of 143.04 g/mol. Its IUPAC name is 1-phosphorosopyrrole-2,5-dione.
| Compound Name | 1-phosphorosopyrrole-2,5-dione |
|---|---|
| PubChem CID | 130463981 |
| Molecular Formula | C4H2NO3P |
| Molecular Weight | 143.04 g/mol |
| Exact Mass | 142.98 |
| IUPAC Name | 1-phosphorosopyrrole-2,5-dione |
| SMILES | O=PN1C(=O)C=CC1=O |
| InChI | InChI=1S/C4H2NO3P/c6-3-1-2-4(7)5(3)9-8/h1-2H |
| InChIKey | DZKWCBUMNVBHQZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.04 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|