C25H27NO2 — CID 147469618
[(3aR,8bS)-2,2-dimethyl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl]-(2-phenyl-1-prop-2-enylcyclopropyl)methanone (PubChem CID 147469618) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [(3aR,8bS)-2,2-dimethyl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl]-(2-phenyl-1-prop-2-enylcyclopropyl)methanone.
| Compound Name | [(3aR,8bS)-2,2-dimethyl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl]-(2-phenyl-1-prop-2-enylcyclopropyl)methanone |
|---|---|
| PubChem CID | 147469618 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | [(3aR,8bS)-2,2-dimethyl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-1-yl]-(2-phenyl-1-prop-2-enylcyclopropyl)methanone |
| SMILES | C=CCC1(C(=O)N2[C@H]3c4ccccc4C[C@H]3OC2(C)C)CC1c1ccccc1 |
| InChI | InChI=1S/C25H27NO2/c1-4-14-25(16-20(25)17-10-6-5-7-11-17)23(27)26-22-19-13-9-8-12-18(19)15-21(22)28-24(26,2)3/h4-13,20-22H,1,14-16H2,2-3H3/t20?,21-,22+,25?/m1/s1 |
| InChIKey | FBMSZHABUAQZEQ-LQDNNDEMSA-N |
| XLogP | 5.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|