C20H25F4N7O3 — CID 147498320
3-amino-N-[3-[3-[(N'-ethylcarbamimidoyl)-methylamino]-3-hydroxypropyl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 147498320) has the molecular formula C20H25F4N7O3 and a molecular weight of 487.46 g/mol. Its IUPAC name is 3-amino-N-[3-[3-[(N'-ethylcarbamimidoyl)-methylamino]-3-hydroxypropyl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[3-[3-[(N'-ethylcarbamimidoyl)-methylamino]-3-hydroxypropyl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 147498320 |
| Molecular Formula | C20H25F4N7O3 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 3-amino-N-[3-[3-[(N'-ethylcarbamimidoyl)-methylamino]-3-hydroxypropyl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CC/N=C(\N)N(C)C(O)CCc1cc(NC(=O)c2ncc(OCC(F)(F)F)nc2N)ccc1F |
| InChI | InChI=1S/C20H25F4N7O3/c1-3-27-19(26)31(2)15(32)7-4-11-8-12(5-6-13(11)21)29-18(33)16-17(25)30-14(9-28-16)34-10-20(22,23)24/h5-6,8-9,15,32H,3-4,7,10H2,1-2H3,(H2,25,30)(H2,26,27)(H,29,33) |
| InChIKey | FGXOATBLTJMGOF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|