C27H26ClFN4O5 — CID 147557628
ethyl 2-[3-[2-(5-chloro-2-pyridinyl)acetyl]-4-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]phenoxy]acetate (PubChem CID 147557628) has the molecular formula C27H26ClFN4O5 and a molecular weight of 540.98 g/mol. Its IUPAC name is ethyl 2-[3-[2-(5-chloro-2-pyridinyl)acetyl]-4-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[2-(5-chloro-2-pyridinyl)acetyl]-4-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]phenoxy]acetate |
|---|---|
| PubChem CID | 147557628 |
| Molecular Formula | C27H26ClFN4O5 |
| Molecular Weight | 540.98 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | ethyl 2-[3-[2-(5-chloro-2-pyridinyl)acetyl]-4-[[4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzoyl]amino]phenoxy]acetate |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OCC(=O)OCC)cc2C(=O)Cc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C27H26ClFN4O5/c1-4-37-25(35)15-38-19-8-10-23(21(13-19)24(34)12-18-7-6-17(28)14-31-18)32-27(36)20-9-5-16(11-22(20)29)26(30)33(2)3/h5-11,13-14,30H,4,12,15H2,1-3H3,(H,32,36)/b30-26- |
| InChIKey | FRZLBHLTUKTOPO-BXVZCJGGSA-N |
| XLogP | 4.38 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.98 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|