C34H57NO4 — CID 14757065
(2R)-2-[[(2R,8aR)-2,8-dimethyl-6-oxo-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-8a-yl]peroxy]-2,4-dimethylpentanenitrile (PubChem CID 14757065) has the molecular formula C34H57NO4 and a molecular weight of 543.83 g/mol. Its IUPAC name is (2R)-2-[[(2R,8aR)-2,8-dimethyl-6-oxo-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-8a-yl]peroxy]-2,4-dimethylpentanenitrile.
| Compound Name | (2R)-2-[[(2R,8aR)-2,8-dimethyl-6-oxo-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-8a-yl]peroxy]-2,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 14757065 |
| Molecular Formula | C34H57NO4 |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 543.43 |
| IUPAC Name | (2R)-2-[[(2R,8aR)-2,8-dimethyl-6-oxo-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-8a-yl]peroxy]-2,4-dimethylpentanenitrile |
| SMILES | CC1=CC(=O)C=C2CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O[C@@]12OO[C@@](C)(C#N)CC(C)C |
| InChI | InChI=1S/C34H57NO4/c1-25(2)13-10-14-27(5)15-11-16-28(6)17-12-19-32(8)20-18-30-22-31(36)21-29(7)34(30,37-32)39-38-33(9,24-35)23-26(3)4/h21-22,25-28H,10-20,23H2,1-9H3/t27-,28-,32-,33-,34-/m1/s1 |
| InChIKey | NELJHVCUKUDFSB-GPTQCAHZSA-N |
| XLogP | 9.42 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|