C27H44O4 — CID 53473638
2,9-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione (PubChem CID 53473638) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2,9-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione.
| Compound Name | 2,9-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione |
|---|---|
| PubChem CID | 53473638 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2,9-dimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-1-oxaspiro[4.5]dec-8-ene-6,7,10-trione |
| SMILES | CC1=CC(=O)C(=O)C2(CCC(C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2)C1=O |
| InChI | InChI=1S/C27H44O4/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-26(6)16-17-27(31-26)24(29)22(5)18-23(28)25(27)30/h18-21H,7-17H2,1-6H3/t20-,21-,26?,27?/m1/s1 |
| InChIKey | USFQEDWNIDDFMY-CUFNRJLSSA-N |
| XLogP | 6.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|