C18H27ClN5O8PS — CID 147597592
1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid (PubChem CID 147597592) has the molecular formula C18H27ClN5O8PS and a molecular weight of 539.94 g/mol. Its IUPAC name is 1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid.
| Compound Name | 1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid |
|---|---|
| PubChem CID | 147597592 |
| Molecular Formula | C18H27ClN5O8PS |
| Molecular Weight | 539.94 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | 1-[[(2S,3S,4R,5R)-5-[5-chloro-7-(cyclopentylamino)triazolo[4,5-b]pyridin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid |
| SMILES | CCC(P(=O)(O)O)S(=O)(=O)C[C@H]1O[C@@H](n2nnc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H27ClN5O8PS/c1-2-13(33(27,28)29)34(30,31)8-11-15(25)16(26)18(32-11)24-17-14(22-23-24)10(7-12(19)21-17)20-9-5-3-4-6-9/h7,9,11,13,15-16,18,25-26H,2-6,8H2,1H3,(H,20,21)(H2,27,28,29)/t11-,13?,15-,16-,18-/m1/s1 |
| InChIKey | FZMMOAZCXFSJHE-HWZMYXJISA-N |
| XLogP | 0.78 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.94 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|