C12H15F3O3S — CID 14772860
3-(benzenesulfonylmethyl)-4,4,4-trifluoro-2-methylbutan-2-ol (PubChem CID 14772860) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-4,4,4-trifluoro-2-methylbutan-2-ol.
| Compound Name | 3-(benzenesulfonylmethyl)-4,4,4-trifluoro-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 14772860 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-4,4,4-trifluoro-2-methylbutan-2-ol |
| SMILES | CC(C)(O)C(CS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O3S/c1-11(2,16)10(12(13,14)15)8-19(17,18)9-6-4-3-5-7-9/h3-7,10,16H,8H2,1-2H3 |
| InChIKey | WTBJQELXLAYZJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |