C25H34F2O4 — CID 147779323
(6aR,10aR)-2,4-difluoro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid (PubChem CID 147779323) has the molecular formula C25H34F2O4 and a molecular weight of 436.54 g/mol. Its IUPAC name is (6aR,10aR)-2,4-difluoro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid.
| Compound Name | (6aR,10aR)-2,4-difluoro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 147779323 |
| Molecular Formula | C25H34F2O4 |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | (6aR,10aR)-2,4-difluoro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
| SMILES | CCCCCCC(C)(C)c1c(F)c(O)c2c(c1F)OC(C)(C)[C@@H]1CC=C(C(=O)O)C[C@@H]21 |
| InChI | InChI=1S/C25H34F2O4/c1-6-7-8-9-12-24(2,3)18-19(26)21(28)17-15-13-14(23(29)30)10-11-16(15)25(4,5)31-22(17)20(18)27/h10,15-16,28H,6-9,11-13H2,1-5H3,(H,29,30)/t15-,16-/m1/s1 |
| InChIKey | HHMBHSNNWXMAMC-HZPDHXFCSA-N |
| XLogP | 6.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|