C25H35ClO4 — CID 153371219
(6aR,10aR)-2-chloro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid (PubChem CID 153371219) has the molecular formula C25H35ClO4 and a molecular weight of 435.00 g/mol. Its IUPAC name is (6aR,10aR)-2-chloro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid.
| Compound Name | (6aR,10aR)-2-chloro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
|---|---|
| PubChem CID | 153371219 |
| Molecular Formula | C25H35ClO4 |
| Molecular Weight | 435.00 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (6aR,10aR)-2-chloro-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
| SMILES | CCCCCCC(C)(C)c1cc2c(c(O)c1Cl)[C@@H]1CC(C(=O)O)=CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C25H35ClO4/c1-6-7-8-9-12-24(2,3)18-14-19-20(22(27)21(18)26)16-13-15(23(28)29)10-11-17(16)25(4,5)30-19/h10,14,16-17,27H,6-9,11-13H2,1-5H3,(H,28,29)/t16-,17-/m1/s1 |
| InChIKey | DQENSJRKZAGYFR-IAGOWNOFSA-N |
| XLogP | 6.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.00 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|