C21H27F3N8O2 — CID 147789343
1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea (PubChem CID 147789343) has the molecular formula C21H27F3N8O2 and a molecular weight of 480.50 g/mol. Its IUPAC name is 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea.
| Compound Name | 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 147789343 |
| Molecular Formula | C21H27F3N8O2 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,4,5-trifluorophenyl)urea |
| SMILES | [H]/N=C(\N)CCCCCN1CCN(c2cnc(NC(=O)Nc3cc(F)c(F)cc3F)[nH]c2=O)CC1 |
| InChI | InChI=1S/C21H27F3N8O2/c22-13-10-15(24)16(11-14(13)23)28-21(34)30-20-27-12-17(19(33)29-20)32-8-6-31(7-9-32)5-3-1-2-4-18(25)26/h10-12H,1-9H2,(H3,25,26)(H3,27,28,29,30,33,34) |
| InChIKey | HJHYASPUBRWSDB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 143.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|