C20H27ClFN9O2 — CID 66581689
1-(3-chloro-2-fluorophenyl)-3-[5-[4-[4-(diaminomethylideneamino)butyl]piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]urea (PubChem CID 66581689) has the molecular formula C20H27ClFN9O2 and a molecular weight of 479.95 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-[5-[4-[4-(diaminomethylideneamino)butyl]piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]urea.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-[5-[4-[4-(diaminomethylideneamino)butyl]piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]urea |
|---|---|
| PubChem CID | 66581689 |
| Molecular Formula | C20H27ClFN9O2 |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-[5-[4-[4-(diaminomethylideneamino)butyl]piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]urea |
| SMILES | NC(N)=NCCCCN1CCN(c2cnc(NC(=O)Nc3cccc(Cl)c3F)[nH]c2=O)CC1 |
| InChI | InChI=1S/C20H27ClFN9O2/c21-13-4-3-5-14(16(13)22)27-20(33)29-19-26-12-15(17(32)28-19)31-10-8-30(9-11-31)7-2-1-6-25-18(23)24/h3-5,12H,1-2,6-11H2,(H4,23,24,25)(H3,26,27,28,29,32,33) |
| InChIKey | PDBARDJYWFIZEW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 157.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|