C21H28F3N9O3 — CID 66581428
1-[5-[4-[3-(diaminomethylideneamino)propyl]-1,4-diazepan-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 66581428) has the molecular formula C21H28F3N9O3 and a molecular weight of 511.51 g/mol. Its IUPAC name is 1-[5-[4-[3-(diaminomethylideneamino)propyl]-1,4-diazepan-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[5-[4-[3-(diaminomethylideneamino)propyl]-1,4-diazepan-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 66581428 |
| Molecular Formula | C21H28F3N9O3 |
| Molecular Weight | 511.51 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 1-[5-[4-[3-(diaminomethylideneamino)propyl]-1,4-diazepan-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | NC(N)=NCCCN1CCCN(c2cnc(NC(=O)Nc3ccccc3OC(F)(F)F)[nH]c2=O)CC1 |
| InChI | InChI=1S/C21H28F3N9O3/c22-21(23,24)36-16-6-2-1-5-14(16)29-20(35)31-19-28-13-15(17(34)30-19)33-10-4-9-32(11-12-33)8-3-7-27-18(25)26/h1-2,5-6,13H,3-4,7-12H2,(H4,25,26,27)(H3,28,29,30,31,34,35) |
| InChIKey | VWVHABMVVGHHEX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 166.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.51 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|