C23H32FN9O3 — CID 118591803
1-[5-[2-[3-(diaminomethylideneamino)propyl]-2,7-diazaspiro[3.5]nonan-7-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea (PubChem CID 118591803) has the molecular formula C23H32FN9O3 and a molecular weight of 501.57 g/mol. Its IUPAC name is 1-[5-[2-[3-(diaminomethylideneamino)propyl]-2,7-diazaspiro[3.5]nonan-7-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea.
| Compound Name | 1-[5-[2-[3-(diaminomethylideneamino)propyl]-2,7-diazaspiro[3.5]nonan-7-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 118591803 |
| Molecular Formula | C23H32FN9O3 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 1-[5-[2-[3-(diaminomethylideneamino)propyl]-2,7-diazaspiro[3.5]nonan-7-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(fluoromethoxy)phenyl]urea |
| SMILES | NC(N)=NCCCN1CC2(CCN(c3cnc(NC(=O)Nc4ccccc4OCF)[nH]c3=O)CC2)C1 |
| InChI | InChI=1S/C23H32FN9O3/c24-15-36-18-5-2-1-4-16(18)29-22(35)31-21-28-12-17(19(34)30-21)33-10-6-23(7-11-33)13-32(14-23)9-3-8-27-20(25)26/h1-2,4-5,12H,3,6-11,13-15H2,(H4,25,26,27)(H3,28,29,30,31,34,35) |
| InChIKey | IVAIDBNEGHLQSK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 166.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|