C22H29F3N8O3 — CID 161282384
1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 161282384) has the molecular formula C22H29F3N8O3 and a molecular weight of 510.52 g/mol. Its IUPAC name is 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 161282384 |
| Molecular Formula | C22H29F3N8O3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 1-[5-[4-(6-amino-6-iminohexyl)piperazin-1-yl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | [H]/N=C(\N)CCCCCN1CCN(c2cnc(NC(=O)Nc3ccccc3OC(F)(F)F)[nH]c2=O)CC1 |
| InChI | InChI=1S/C22H29F3N8O3/c23-22(24,25)36-17-7-4-3-6-15(17)29-21(35)31-20-28-14-16(19(34)30-20)33-12-10-32(11-13-33)9-5-1-2-8-18(26)27/h3-4,6-7,14H,1-2,5,8-13H2,(H3,26,27)(H3,28,29,30,31,34,35) |
| InChIKey | VFGLOBUIFHOTLX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 152.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|