C22H27N2O2PS — CID 14783635
2-[4-[[azepan-1-yl(ethoxy)phosphoryl]methyl]phenyl]-1,3-benzothiazole (PubChem CID 14783635) has the molecular formula C22H27N2O2PS and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[4-[[azepan-1-yl(ethoxy)phosphoryl]methyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[4-[[azepan-1-yl(ethoxy)phosphoryl]methyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 14783635 |
| Molecular Formula | C22H27N2O2PS |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[4-[[azepan-1-yl(ethoxy)phosphoryl]methyl]phenyl]-1,3-benzothiazole |
| SMILES | CCOP(=O)(Cc1ccc(-c2nc3ccccc3s2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H27N2O2PS/c1-2-26-27(25,24-15-7-3-4-8-16-24)17-18-11-13-19(14-12-18)22-23-20-9-5-6-10-21(20)28-22/h5-6,9-14H,2-4,7-8,15-17H2,1H3 |
| InChIKey | LDEIQRSDRLBGDN-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|