C13H17N2OPS — CID 3404373
2-[methyl(piperidin-1-yl)phosphoryl]-1,3-benzothiazole (PubChem CID 3404373) has the molecular formula C13H17N2OPS and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-[methyl(piperidin-1-yl)phosphoryl]-1,3-benzothiazole.
| Compound Name | 2-[methyl(piperidin-1-yl)phosphoryl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3404373 |
| Molecular Formula | C13H17N2OPS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[methyl(piperidin-1-yl)phosphoryl]-1,3-benzothiazole |
| SMILES | CP(=O)(c1nc2ccccc2s1)N1CCCCC1 |
| InChI | InChI=1S/C13H17N2OPS/c1-17(16,15-9-5-2-6-10-15)13-14-11-7-3-4-8-12(11)18-13/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | FKEQLHCPAMKGHC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|