About 4-methanidylpentan-2-one;yttrium
4-methanidylpentan-2-one;yttrium (PubChem CID 147863324) has the molecular formula C6H10OY-2
and a molecular weight of 187.05 g/mol. Its IUPAC name is 4-methanidylpentan-2-one;yttrium.
Molecular Properties
| Compound Name | 4-methanidylpentan-2-one;yttrium |
| PubChem CID | 147863324 |
| Molecular Formula | C6H10OY-2 |
| Molecular Weight | 187.05 g/mol |
| Exact Mass | 186.98 |
| IUPAC Name | 4-methanidylpentan-2-one;yttrium |
| SMILES | [CH2-]C(=O)CC([CH2-])C.[Y] |
| InChI | InChI=1S/C6H10O.Y/c1-5(2)4-6(3)7;/h5H,1,3-4H2,2H3;/q-2; |
| InChIKey | WZLVVWPDLNGOGB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.05 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methanidylpentan-2-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methanidylpentan-2-one;yttrium?
The IUPAC name of 4-methanidylpentan-2-one;yttrium (CID 147863324) is 4-methanidylpentan-2-one;yttrium.
What is the SMILES notation for 4-methanidylpentan-2-one;yttrium?
The canonical SMILES for 4-methanidylpentan-2-one;yttrium is [CH2-]C(=O)CC([CH2-])C.[Y].
What is the InChIKey of 4-methanidylpentan-2-one;yttrium?
The InChIKey is WZLVVWPDLNGOGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.Y/c1-5(2)4-6(3)7;/h5H,1,3-4H2,2H3;/q-2;.
What are the key properties of 4-methanidylpentan-2-one;yttrium?
4-methanidylpentan-2-one;yttrium has a molecular weight of 187.05 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methanidylpentan-2-one;yttrium is sourced from PubChem (CID 147863324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).