C38H45N3O14 — CID 147993414
4-[[2-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-phenylmethoxycarbonylphenyl]phenoxy]-1-hydroxyethyl]amino]butanoic acid (PubChem CID 147993414) has the molecular formula C38H45N3O14 and a molecular weight of 767.78 g/mol. Its IUPAC name is 4-[[2-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-phenylmethoxycarbonylphenyl]phenoxy]-1-hydroxyethyl]amino]butanoic acid.
| Compound Name | 4-[[2-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-phenylmethoxycarbonylphenyl]phenoxy]-1-hydroxyethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 147993414 |
| Molecular Formula | C38H45N3O14 |
| Molecular Weight | 767.78 g/mol |
| Exact Mass | 767.29 |
| IUPAC Name | 4-[[2-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-[3-[2-(3-carboxypropylamino)-2-oxoethoxy]-5-phenylmethoxycarbonylphenyl]phenoxy]-1-hydroxyethyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)COc1cc(OCC(O)NCCCC(=O)O)cc(-c2cc(OCC(=O)NCCCC(=O)O)cc(C(=O)OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C38H45N3O14/c42-32(39-12-4-9-35(45)46)22-52-29-16-26(15-28(19-29)38(51)55-21-25-7-2-1-3-8-25)27-17-30(53-23-33(43)40-13-5-10-36(47)48)20-31(18-27)54-24-34(44)41-14-6-11-37(49)50/h1-3,7-8,15-20,33,40,43H,4-6,9-14,21-24H2,(H,39,42)(H,41,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | IVNKBRRKJKSTRV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 256.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|