About [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate
[(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate (PubChem CID 14814558) has the molecular formula C15H10N2O2S
and a molecular weight of 282.32 g/mol. Its IUPAC name is [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate.
Molecular Properties
| Compound Name | [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate |
| PubChem CID | 14814558 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate |
| SMILES | N#CS/C(=C(/c1ccccc1)[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2S/c16-11-20-15(13-9-5-2-6-10-13)14(17(18)19)12-7-3-1-4-8-12/h1-10H/b15-14- |
| InChIKey | QVTKYHASYOXHQZ-PFONDFGASA-N |
| XLogP | 4.00 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate?
The IUPAC name of [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate (CID 14814558) is [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate.
What is the SMILES notation for [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate?
The canonical SMILES for [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate is N#CS/C(=C(/c1ccccc1)[N+](=O)[O-])c1ccccc1.
What is the InChIKey of [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate?
The InChIKey is QVTKYHASYOXHQZ-PFONDFGASA-N. The full InChI is InChI=1S/C15H10N2O2S/c16-11-20-15(13-9-5-2-6-10-13)14(17(18)19)12-7-3-1-4-8-12/h1-10H/b15-14-.
What are the key properties of [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate?
[(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate has a molecular weight of 282.32 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-2-nitro-1,2-diphenylethenyl] thiocyanate is sourced from PubChem (CID 14814558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).