C15H14N2O4S — CID 1484640
N-(1,3-benzodioxol-5-ylmethyl)-2-pyridin-4-ylethenesulfonamide (PubChem CID 1484640) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-pyridin-4-ylethenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-pyridin-4-ylethenesulfonamide |
|---|---|
| PubChem CID | 1484640 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-pyridin-4-ylethenesulfonamide |
| SMILES | O=S(=O)(C=Cc1ccncc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O4S/c18-22(19,8-5-12-3-6-16-7-4-12)17-10-13-1-2-14-15(9-13)21-11-20-14/h1-9,17H,10-11H2 |
| InChIKey | DNOIVONXZKNPJP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |