C30H27ClN4O2S — CID 14851917
2-[2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 14851917) has the molecular formula C30H27ClN4O2S and a molecular weight of 543.09 g/mol. Its IUPAC name is 2-[2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 2-[2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 14851917 |
| Molecular Formula | C30H27ClN4O2S |
| Molecular Weight | 543.09 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-[2-[7-(2-chlorophenyl)-13-methyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-4-yl]ethynyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(C#Cc1cc3c(s1)-n1c(C)nnc1CN=C3c1ccccc1Cl)O2 |
| InChI | InChI=1S/C30H27ClN4O2S/c1-16-17(2)28-21(18(3)27(16)36)11-13-30(5,37-28)12-10-20-14-23-26(22-8-6-7-9-24(22)31)32-15-25-34-33-19(4)35(25)29(23)38-20/h6-9,14,36H,11,13,15H2,1-5H3 |
| InChIKey | ATPWYCAXVNKUNL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.09 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|