C28H29O3S+ — CID 148672487
(4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)-(4-methoxyphenyl)-[4-(4-methylphenoxy)phenyl]sulfanium (PubChem CID 148672487) has the molecular formula C28H29O3S+ and a molecular weight of 445.60 g/mol. Its IUPAC name is (4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)-(4-methoxyphenyl)-[4-(4-methylphenoxy)phenyl]sulfanium.
| Compound Name | (4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)-(4-methoxyphenyl)-[4-(4-methylphenoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 148672487 |
| Molecular Formula | C28H29O3S+ |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (4-methoxy-4-methylcyclohexa-1,5-dien-1-yl)-(4-methoxyphenyl)-[4-(4-methylphenoxy)phenyl]sulfanium |
| SMILES | COc1ccc([S+](C2=CCC(C)(OC)C=C2)c2ccc(Oc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H29O3S/c1-21-5-7-23(8-6-21)31-24-11-15-26(16-12-24)32(25-13-9-22(29-3)10-14-25)27-17-19-28(2,30-4)20-18-27/h5-19H,20H2,1-4H3/q+1 |
| InChIKey | NPZMJGKUWBCKFZ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|