C16H12ClF3N2O3S — CID 14868678
2-chloro-1-[6-methyl-5,5-dioxo-2-(trifluoromethyl)benzo[c][2,1,5]benzothiadiazepin-11-yl]ethanone (PubChem CID 14868678) has the molecular formula C16H12ClF3N2O3S and a molecular weight of 404.80 g/mol. Its IUPAC name is 2-chloro-1-[6-methyl-5,5-dioxo-2-(trifluoromethyl)benzo[c][2,1,5]benzothiadiazepin-11-yl]ethanone.
| Compound Name | 2-chloro-1-[6-methyl-5,5-dioxo-2-(trifluoromethyl)benzo[c][2,1,5]benzothiadiazepin-11-yl]ethanone |
|---|---|
| PubChem CID | 14868678 |
| Molecular Formula | C16H12ClF3N2O3S |
| Molecular Weight | 404.80 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 2-chloro-1-[6-methyl-5,5-dioxo-2-(trifluoromethyl)benzo[c][2,1,5]benzothiadiazepin-11-yl]ethanone |
| SMILES | CN1c2ccccc2N(C(=O)CCl)c2cc(C(F)(F)F)ccc2S1(=O)=O |
| InChI | InChI=1S/C16H12ClF3N2O3S/c1-21-11-4-2-3-5-12(11)22(15(23)9-17)13-8-10(16(18,19)20)6-7-14(13)26(21,24)25/h2-8H,9H2,1H3 |
| InChIKey | LPSHSPZZCBUHSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|